About 1,4-diethylbenzene;heptane
1,4-diethylbenzene;heptane (PubChem CID 175370860) has the molecular formula C17H30
and a molecular weight of 234.43 g/mol. Its IUPAC name is 1,4-diethylbenzene;heptane.
Molecular Properties
| Compound Name | 1,4-diethylbenzene;heptane |
| PubChem CID | 175370860 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 1,4-diethylbenzene;heptane |
| SMILES | CCCCCCC.CCc1ccc(CC)cc1 |
| InChI | InChI=1S/C10H14.C7H16/c1-3-9-5-7-10(4-2)8-6-9;1-3-5-7-6-4-2/h5-8H,3-4H2,1-2H3;3-7H2,1-2H3 |
| InChIKey | KGNNVTRREJWDHL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diethylbenzene;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethylbenzene;heptane?
The IUPAC name of 1,4-diethylbenzene;heptane (CID 175370860) is 1,4-diethylbenzene;heptane.
What is the SMILES notation for 1,4-diethylbenzene;heptane?
The canonical SMILES for 1,4-diethylbenzene;heptane is CCCCCCC.CCc1ccc(CC)cc1.
What is the InChIKey of 1,4-diethylbenzene;heptane?
The InChIKey is KGNNVTRREJWDHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C7H16/c1-3-9-5-7-10(4-2)8-6-9;1-3-5-7-6-4-2/h5-8H,3-4H2,1-2H3;3-7H2,1-2H3.
What are the key properties of 1,4-diethylbenzene;heptane?
1,4-diethylbenzene;heptane has a molecular weight of 234.43 g/mol, XLogP of 5.79, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethylbenzene;heptane is sourced from PubChem (CID 175370860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).