About (4-ethylphenyl)boronic acid;octane
(4-ethylphenyl)boronic acid;octane (PubChem CID 165134887) has the molecular formula C16H29BO2
and a molecular weight of 264.22 g/mol. Its IUPAC name is (4-ethylphenyl)boronic acid;octane.
Molecular Properties
| Compound Name | (4-ethylphenyl)boronic acid;octane |
| PubChem CID | 165134887 |
| Molecular Formula | C16H29BO2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | (4-ethylphenyl)boronic acid;octane |
| SMILES | CCCCCCCC.CCc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C8H11BO2.C8H18/c1-2-7-3-5-8(6-4-7)9(10)11;1-3-5-7-8-6-4-2/h3-6,10-11H,2H2,1H3;3-8H2,1-2H3 |
| InChIKey | NMPCILXZBXDFEF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylphenyl)boronic acid;octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl)boronic acid;octane?
The IUPAC name of (4-ethylphenyl)boronic acid;octane (CID 165134887) is (4-ethylphenyl)boronic acid;octane.
What is the SMILES notation for (4-ethylphenyl)boronic acid;octane?
The canonical SMILES for (4-ethylphenyl)boronic acid;octane is CCCCCCCC.CCc1ccc(B(O)O)cc1.
What is the InChIKey of (4-ethylphenyl)boronic acid;octane?
The InChIKey is NMPCILXZBXDFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BO2.C8H18/c1-2-7-3-5-8(6-4-7)9(10)11;1-3-5-7-8-6-4-2/h3-6,10-11H,2H2,1H3;3-8H2,1-2H3.
What are the key properties of (4-ethylphenyl)boronic acid;octane?
(4-ethylphenyl)boronic acid;octane has a molecular weight of 264.22 g/mol, XLogP of 3.30, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl)boronic acid;octane is sourced from PubChem (CID 165134887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).