C9H12INO3S — CID 14763212
3-(4-iodoanilino)propane-1-sulfonic acid (PubChem CID 14763212) has the molecular formula C9H12INO3S and a molecular weight of 341.17 g/mol. Its IUPAC name is 3-(4-iodoanilino)propane-1-sulfonic acid.
| Compound Name | 3-(4-iodoanilino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 14763212 |
| Molecular Formula | C9H12INO3S |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | 3-(4-iodoanilino)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNc1ccc(I)cc1 |
| InChI | InChI=1S/C9H12INO3S/c10-8-2-4-9(5-3-8)11-6-1-7-15(12,13)14/h2-5,11H,1,6-7H2,(H,12,13,14) |
| InChIKey | ZIEZYPNAPAHKPK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|