C9H11Br2NO4S — CID 56983996
3-(3,5-dibromo-4-hydroxyanilino)propane-1-sulfonic acid (PubChem CID 56983996) has the molecular formula C9H11Br2NO4S and a molecular weight of 389.07 g/mol. Its IUPAC name is 3-(3,5-dibromo-4-hydroxyanilino)propane-1-sulfonic acid.
| Compound Name | 3-(3,5-dibromo-4-hydroxyanilino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 56983996 |
| Molecular Formula | C9H11Br2NO4S |
| Molecular Weight | 389.07 g/mol |
| Exact Mass | 386.88 |
| IUPAC Name | 3-(3,5-dibromo-4-hydroxyanilino)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C9H11Br2NO4S/c10-7-4-6(5-8(11)9(7)13)12-2-1-3-17(14,15)16/h4-5,12-13H,1-3H2,(H,14,15,16) |
| InChIKey | AQXMUUZKKYJXTL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.07 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|