C11H16ClNO5S2 — CID 19078111
4-[3-(2-chloroethylsulfonyl)propylamino]benzenesulfonic acid (PubChem CID 19078111) has the molecular formula C11H16ClNO5S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 4-[3-(2-chloroethylsulfonyl)propylamino]benzenesulfonic acid.
| Compound Name | 4-[3-(2-chloroethylsulfonyl)propylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 19078111 |
| Molecular Formula | C11H16ClNO5S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-[3-(2-chloroethylsulfonyl)propylamino]benzenesulfonic acid |
| SMILES | O=S(=O)(CCCl)CCCNc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H16ClNO5S2/c12-6-9-19(14,15)8-1-7-13-10-2-4-11(5-3-10)20(16,17)18/h2-5,13H,1,6-9H2,(H,16,17,18) |
| InChIKey | OINFIAJYOYQWTK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|