C9H10N2O3S — CID 82041013
4-(2-cyanoethylamino)benzenesulfonic acid (PubChem CID 82041013) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is 4-(2-cyanoethylamino)benzenesulfonic acid.
| Compound Name | 4-(2-cyanoethylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 82041013 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 4-(2-cyanoethylamino)benzenesulfonic acid |
| SMILES | N#CCCNc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H10N2O3S/c10-6-1-7-11-8-2-4-9(5-3-8)15(12,13)14/h2-5,11H,1,7H2,(H,12,13,14) |
| InChIKey | GDPYUFHXBHWRCC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|