C10H8N4O3S — CID 88780104
4-[(1-amino-2,2-dicyanoethenyl)amino]benzenesulfonic acid (PubChem CID 88780104) has the molecular formula C10H8N4O3S and a molecular weight of 264.27 g/mol. Its IUPAC name is 4-[(1-amino-2,2-dicyanoethenyl)amino]benzenesulfonic acid.
| Compound Name | 4-[(1-amino-2,2-dicyanoethenyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 88780104 |
| Molecular Formula | C10H8N4O3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 4-[(1-amino-2,2-dicyanoethenyl)amino]benzenesulfonic acid |
| SMILES | N#CC(C#N)=C(N)Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H8N4O3S/c11-5-7(6-12)10(13)14-8-1-3-9(4-2-8)18(15,16)17/h1-4,14H,13H2,(H,15,16,17) |
| InChIKey | YVLQNVOOEGIAAB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|