C18H23N3O3S — CID 100963290
4-[[4-(hexylamino)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 100963290) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 4-[[4-(hexylamino)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[4-(hexylamino)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 100963290 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 4-[[4-(hexylamino)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | CCCCCCNc1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H23N3O3S/c1-2-3-4-5-14-19-15-6-8-16(9-7-15)20-21-17-10-12-18(13-11-17)25(22,23)24/h6-13,19H,2-5,14H2,1H3,(H,22,23,24)/b21-20+ |
| InChIKey | KMEKYXBXWFOOCV-QZQOTICOSA-N |
| XLogP | 5.34 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|