About 4-(pentylamino)benzoate
4-(pentylamino)benzoate (PubChem CID 53422656) has the molecular formula C12H16NO2-
and a molecular weight of 206.27 g/mol. Its IUPAC name is 4-(pentylamino)benzoate.
Molecular Properties
| Compound Name | 4-(pentylamino)benzoate |
| PubChem CID | 53422656 |
| Molecular Formula | C12H16NO2- |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 4-(pentylamino)benzoate |
| SMILES | CCCCCNc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C12H17NO2/c1-2-3-4-9-13-11-7-5-10(6-8-11)12(14)15/h5-8,13H,2-4,9H2,1H3,(H,14,15)/p-1 |
| InChIKey | PEIGTVJQKKVZSK-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(pentylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(pentylamino)benzoate?
The IUPAC name of 4-(pentylamino)benzoate (CID 53422656) is 4-(pentylamino)benzoate.
What is the SMILES notation for 4-(pentylamino)benzoate?
The canonical SMILES for 4-(pentylamino)benzoate is CCCCCNc1ccc(C(=O)[O-])cc1.
What is the InChIKey of 4-(pentylamino)benzoate?
The InChIKey is PEIGTVJQKKVZSK-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H17NO2/c1-2-3-4-9-13-11-7-5-10(6-8-11)12(14)15/h5-8,13H,2-4,9H2,1H3,(H,14,15)/p-1.
What are the key properties of 4-(pentylamino)benzoate?
4-(pentylamino)benzoate has a molecular weight of 206.27 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(pentylamino)benzoate is sourced from PubChem (CID 53422656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).