C24H31NO2 — CID 21318895
2-methyl-1-[4-(octylamino)phenyl]-3-phenylpropane-1,3-dione (PubChem CID 21318895) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-methyl-1-[4-(octylamino)phenyl]-3-phenylpropane-1,3-dione.
| Compound Name | 2-methyl-1-[4-(octylamino)phenyl]-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 21318895 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 2-methyl-1-[4-(octylamino)phenyl]-3-phenylpropane-1,3-dione |
| SMILES | CCCCCCCCNc1ccc(C(=O)C(C)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO2/c1-3-4-5-6-7-11-18-25-22-16-14-21(15-17-22)24(27)19(2)23(26)20-12-9-8-10-13-20/h8-10,12-17,19,25H,3-7,11,18H2,1-2H3 |
| InChIKey | WZJNQYRKJQPWIX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|