C20H29NNa2O4 — CID 70562640
disodium;4-(dodecylamino)phthalate (PubChem CID 70562640) has the molecular formula C20H29NNa2O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is disodium;4-(dodecylamino)phthalate.
| Compound Name | disodium;4-(dodecylamino)phthalate |
|---|---|
| PubChem CID | 70562640 |
| Molecular Formula | C20H29NNa2O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | disodium;4-(dodecylamino)phthalate |
| SMILES | CCCCCCCCCCCCNc1ccc(C(=O)[O-])c(C(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C20H31NO4.2Na/c1-2-3-4-5-6-7-8-9-10-11-14-21-16-12-13-17(19(22)23)18(15-16)20(24)25;;/h12-13,15,21H,2-11,14H2,1H3,(H,22,23)(H,24,25);;/q;2*+1/p-2 |
| InChIKey | GIENIPYGLZLYDA-UHFFFAOYSA-L |
| XLogP | -3.25 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|