C18H22NNa3O6 — CID 70562799
trisodium;5-(nonylamino)benzene-1,2,3-tricarboxylate (PubChem CID 70562799) has the molecular formula C18H22NNa3O6 and a molecular weight of 417.35 g/mol. Its IUPAC name is trisodium;5-(nonylamino)benzene-1,2,3-tricarboxylate.
| Compound Name | trisodium;5-(nonylamino)benzene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 70562799 |
| Molecular Formula | C18H22NNa3O6 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | trisodium;5-(nonylamino)benzene-1,2,3-tricarboxylate |
| SMILES | CCCCCCCCCNc1cc(C(=O)[O-])c(C(=O)[O-])c(C(=O)[O-])c1.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C18H25NO6.3Na/c1-2-3-4-5-6-7-8-9-19-12-10-13(16(20)21)15(18(24)25)14(11-12)17(22)23;;;/h10-11,19H,2-9H2,1H3,(H,20,21)(H,22,23)(H,24,25);;;/q;3*+1/p-3 |
| InChIKey | HAEUGSHJXJTMHQ-UHFFFAOYSA-K |
| XLogP | -9.05 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | -9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|