C24H40NNaO3S — CID 88697998
sodium 4-[[(Z)-octadec-9-enyl]amino]benzenesulfonate (PubChem CID 88697998) has the molecular formula C24H40NNaO3S and a molecular weight of 445.65 g/mol. Its IUPAC name is sodium 4-[[(Z)-octadec-9-enyl]amino]benzenesulfonate.
| Compound Name | sodium 4-[[(Z)-octadec-9-enyl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 88697998 |
| Molecular Formula | C24H40NNaO3S |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | sodium 4-[[(Z)-octadec-9-enyl]amino]benzenesulfonate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C24H41NO3S.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-25-23-18-20-24(21-19-23)29(26,27)28;/h9-10,18-21,25H,2-8,11-17,22H2,1H3,(H,26,27,28);/q;+1/p-1/b10-9-; |
| InChIKey | HBCQZUBYAZPOIG-KVVVOXFISA-M |
| XLogP | 4.04 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|