C25H43NO4S — CID 154161011
[4-(octadec-9-enylamino)phenoxy]methanesulfonic acid (PubChem CID 154161011) has the molecular formula C25H43NO4S and a molecular weight of 453.69 g/mol. Its IUPAC name is [4-(octadec-9-enylamino)phenoxy]methanesulfonic acid.
| Compound Name | [4-(octadec-9-enylamino)phenoxy]methanesulfonic acid |
|---|---|
| PubChem CID | 154161011 |
| Molecular Formula | C25H43NO4S |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | [4-(octadec-9-enylamino)phenoxy]methanesulfonic acid |
| SMILES | CCCCCCCCC=CCCCCCCCCNc1ccc(OCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C25H43NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-26-24-18-20-25(21-19-24)30-23-31(27,28)29/h9-10,18-21,26H,2-8,11-17,22-23H2,1H3,(H,27,28,29) |
| InChIKey | XOSWYIYVTVRFGU-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|