C23H33NO2 — CID 54256501
3-[4-(tetradec-4-enylamino)phenyl]prop-2-ynoic acid (PubChem CID 54256501) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 3-[4-(tetradec-4-enylamino)phenyl]prop-2-ynoic acid.
| Compound Name | 3-[4-(tetradec-4-enylamino)phenyl]prop-2-ynoic acid |
|---|---|
| PubChem CID | 54256501 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 3-[4-(tetradec-4-enylamino)phenyl]prop-2-ynoic acid |
| SMILES | CCCCCCCCCC=CCCCNc1ccc(C#CC(=O)O)cc1 |
| InChI | InChI=1S/C23H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-20-24-22-17-14-21(15-18-22)16-19-23(25)26/h10-11,14-15,17-18,24H,2-9,12-13,20H2,1H3,(H,25,26) |
| InChIKey | RALBBQPNFQCVDB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|