C25H43NNaO4S — CID 170845045
CID 170845045 (PubChem CID 170845045) has the molecular formula C25H43NNaO4S and a molecular weight of 476.68 g/mol.
| Compound Name | CID 170845045 |
|---|---|
| PubChem CID | 170845045 |
| Molecular Formula | C25H43NNaO4S |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | — |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNc1ccc(OC)cc1S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C25H43NO4S.Na/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-26-24-20-19-23(30-2)22-25(24)31(27,28)29;/h10-11,19-20,22,26H,3-9,12-18,21H2,1-2H3,(H,27,28,29);/b11-10-; |
| InChIKey | BBVRYVIHLDCNCY-GMFCBQQYSA-N |
| XLogP | 7.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|