C25H43NO4S — CID 6437235
5-methoxy-2-[[(E)-octadec-9-enyl]amino]benzenesulfonic acid (PubChem CID 6437235) has the molecular formula C25H43NO4S and a molecular weight of 453.69 g/mol. Its IUPAC name is 5-methoxy-2-[[(E)-octadec-9-enyl]amino]benzenesulfonic acid.
| Compound Name | 5-methoxy-2-[[(E)-octadec-9-enyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 6437235 |
| Molecular Formula | C25H43NO4S |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 5-methoxy-2-[[(E)-octadec-9-enyl]amino]benzenesulfonic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCCNc1ccc(OC)cc1S(=O)(=O)O |
| InChI | InChI=1S/C25H43NO4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-26-24-20-19-23(30-2)22-25(24)31(27,28)29/h10-11,19-20,22,26H,3-9,12-18,21H2,1-2H3,(H,27,28,29)/b11-10+ |
| InChIKey | CLYCOKSLBZVDGR-ZHACJKMWSA-N |
| XLogP | 7.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|