C12H17NO5S — CID 121003501
2-(2,2-dimethylpropanoylamino)-5-methoxybenzenesulfonic acid (PubChem CID 121003501) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-5-methoxybenzenesulfonic acid.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-5-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 121003501 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-5-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(NC(=O)C(C)(C)C)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C12H17NO5S/c1-12(2,3)11(14)13-9-6-5-8(18-4)7-10(9)19(15,16)17/h5-7H,1-4H3,(H,13,14)(H,15,16,17) |
| InChIKey | QSERYRHTESIOGF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|