C16H25NO5S — CID 89322073
ethyl 2-(2,2-dimethylpentanoylamino)-5-methoxybenzenesulfonate (PubChem CID 89322073) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is ethyl 2-(2,2-dimethylpentanoylamino)-5-methoxybenzenesulfonate.
| Compound Name | ethyl 2-(2,2-dimethylpentanoylamino)-5-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 89322073 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | ethyl 2-(2,2-dimethylpentanoylamino)-5-methoxybenzenesulfonate |
| SMILES | CCCC(C)(C)C(=O)Nc1ccc(OC)cc1S(=O)(=O)OCC |
| InChI | InChI=1S/C16H25NO5S/c1-6-10-16(3,4)15(18)17-13-9-8-12(21-5)11-14(13)23(19,20)22-7-2/h8-9,11H,6-7,10H2,1-5H3,(H,17,18) |
| InChIKey | FRCYSENTRLADMB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|