C10H8N4O4S — CID 169341790
2-[2-(dicyanomethylidene)hydrazinyl]-5-methoxybenzenesulfonic acid (PubChem CID 169341790) has the molecular formula C10H8N4O4S and a molecular weight of 280.27 g/mol. Its IUPAC name is 2-[2-(dicyanomethylidene)hydrazinyl]-5-methoxybenzenesulfonic acid.
| Compound Name | 2-[2-(dicyanomethylidene)hydrazinyl]-5-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 169341790 |
| Molecular Formula | C10H8N4O4S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-[2-(dicyanomethylidene)hydrazinyl]-5-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(NN=C(C#N)C#N)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H8N4O4S/c1-18-8-2-3-9(10(4-8)19(15,16)17)14-13-7(5-11)6-12/h2-4,14H,1H3,(H,15,16,17) |
| InChIKey | KARPXDHJRYSWDQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 135.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|