C11H10N4O3S — CID 169341716
2-[2-(dicyanomethylidene)hydrazinyl]-3,5-dimethylbenzenesulfonic acid (PubChem CID 169341716) has the molecular formula C11H10N4O3S and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-[2-(dicyanomethylidene)hydrazinyl]-3,5-dimethylbenzenesulfonic acid.
| Compound Name | 2-[2-(dicyanomethylidene)hydrazinyl]-3,5-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 169341716 |
| Molecular Formula | C11H10N4O3S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[2-(dicyanomethylidene)hydrazinyl]-3,5-dimethylbenzenesulfonic acid |
| SMILES | Cc1cc(C)c(NN=C(C#N)C#N)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H10N4O3S/c1-7-3-8(2)11(10(4-7)19(16,17)18)15-14-9(5-12)6-13/h3-4,15H,1-2H3,(H,16,17,18) |
| InChIKey | UUPJNVJLDFLFNC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|