C13H8N4O6S2 — CID 169337655
7-[2-(dicyanomethylidene)hydrazinyl]naphthalene-1,3-disulfonic acid (PubChem CID 169337655) has the molecular formula C13H8N4O6S2 and a molecular weight of 380.36 g/mol. Its IUPAC name is 7-[2-(dicyanomethylidene)hydrazinyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[2-(dicyanomethylidene)hydrazinyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 169337655 |
| Molecular Formula | C13H8N4O6S2 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 7-[2-(dicyanomethylidene)hydrazinyl]naphthalene-1,3-disulfonic acid |
| SMILES | N#CC(C#N)=NNc1ccc2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C13H8N4O6S2/c14-6-10(7-15)17-16-9-2-1-8-3-11(24(18,19)20)5-13(12(8)4-9)25(21,22)23/h1-5,16H,(H,18,19,20)(H,21,22,23) |
| InChIKey | YEAQWIMOJVSRJC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 180.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|