C13H11FN4O6S2 — CID 173374842
7-[(6-fluoro-1H-triazin-2-yl)amino]naphthalene-1,3-disulfonic acid (PubChem CID 173374842) has the molecular formula C13H11FN4O6S2 and a molecular weight of 402.39 g/mol. Its IUPAC name is 7-[(6-fluoro-1H-triazin-2-yl)amino]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[(6-fluoro-1H-triazin-2-yl)amino]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 173374842 |
| Molecular Formula | C13H11FN4O6S2 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 7-[(6-fluoro-1H-triazin-2-yl)amino]naphthalene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2cc(NN3N=CC=C(F)N3)ccc2c1 |
| InChI | InChI=1S/C13H11FN4O6S2/c14-13-3-4-15-18(17-13)16-9-2-1-8-5-10(25(19,20)21)7-12(11(8)6-9)26(22,23)24/h1-7,16-17H,(H,19,20,21)(H,22,23,24) |
| InChIKey | HWZRQYKIGAHBPI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|