C14H18N2O5S — CID 15450988
4-hydroxy-6-[2-(2-hydroxyethylamino)ethylamino]naphthalene-2-sulfonic acid (PubChem CID 15450988) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 4-hydroxy-6-[2-(2-hydroxyethylamino)ethylamino]naphthalene-2-sulfonic acid.
| Compound Name | 4-hydroxy-6-[2-(2-hydroxyethylamino)ethylamino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 15450988 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-hydroxy-6-[2-(2-hydroxyethylamino)ethylamino]naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2cc(NCCNCCO)ccc2c1 |
| InChI | InChI=1S/C14H18N2O5S/c17-6-5-15-3-4-16-11-2-1-10-7-12(22(19,20)21)9-14(18)13(10)8-11/h1-2,7-9,15-18H,3-6H2,(H,19,20,21) |
| InChIKey | UAEJYCCWTULGMS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|