C13H13NO6S — CID 23367264
2-[(8-hydroxy-6-sulfonaphthalen-2-yl)amino]propanoic acid (PubChem CID 23367264) has the molecular formula C13H13NO6S and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-[(8-hydroxy-6-sulfonaphthalen-2-yl)amino]propanoic acid.
| Compound Name | 2-[(8-hydroxy-6-sulfonaphthalen-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 23367264 |
| Molecular Formula | C13H13NO6S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-[(8-hydroxy-6-sulfonaphthalen-2-yl)amino]propanoic acid |
| SMILES | CC(Nc1ccc2cc(S(=O)(=O)O)cc(O)c2c1)C(=O)O |
| InChI | InChI=1S/C13H13NO6S/c1-7(13(16)17)14-9-3-2-8-4-10(21(18,19)20)6-12(15)11(8)5-9/h2-7,14-15H,1H3,(H,16,17)(H,18,19,20) |
| InChIKey | RLLSYUQPSOHINL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|