C16H12ClNO5S — CID 174450871
6-(5-chloro-2-hydroxyanilino)-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 174450871) has the molecular formula C16H12ClNO5S and a molecular weight of 365.79 g/mol. Its IUPAC name is 6-(5-chloro-2-hydroxyanilino)-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-(5-chloro-2-hydroxyanilino)-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 174450871 |
| Molecular Formula | C16H12ClNO5S |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 6-(5-chloro-2-hydroxyanilino)-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2cc(Nc3cc(Cl)ccc3O)ccc2c1 |
| InChI | InChI=1S/C16H12ClNO5S/c17-10-2-4-15(19)14(6-10)18-11-3-1-9-5-12(24(21,22)23)8-16(20)13(9)7-11/h1-8,18-20H,(H,21,22,23) |
| InChIKey | JZGGAVCKDXDZHW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|