C17H20N6O6S — CID 11719055
7-[[4,6-bis(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 11719055) has the molecular formula C17H20N6O6S and a molecular weight of 436.45 g/mol. Its IUPAC name is 7-[[4,6-bis(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-[[4,6-bis(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 11719055 |
| Molecular Formula | C17H20N6O6S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 7-[[4,6-bis(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2ccc(Nc3nc(NCCO)nc(NCCO)n3)cc2c1 |
| InChI | InChI=1S/C17H20N6O6S/c24-5-3-18-15-21-16(19-4-6-25)23-17(22-15)20-11-1-2-13-10(7-11)8-12(9-14(13)26)30(27,28)29/h1-2,7-9,24-26H,3-6H2,(H,27,28,29)(H3,18,19,20,21,22,23) |
| InChIKey | SHLGGQGNSDUHPD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 189.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|