C17H13NO6S — CID 15450962
3-[(5-hydroxy-7-sulfonaphthalen-2-yl)amino]benzoic acid (PubChem CID 15450962) has the molecular formula C17H13NO6S and a molecular weight of 359.36 g/mol. Its IUPAC name is 3-[(5-hydroxy-7-sulfonaphthalen-2-yl)amino]benzoic acid.
| Compound Name | 3-[(5-hydroxy-7-sulfonaphthalen-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 15450962 |
| Molecular Formula | C17H13NO6S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 3-[(5-hydroxy-7-sulfonaphthalen-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2ccc3c(O)cc(S(=O)(=O)O)cc3c2)c1 |
| InChI | InChI=1S/C17H13NO6S/c19-16-9-14(25(22,23)24)8-11-7-13(4-5-15(11)16)18-12-3-1-2-10(6-12)17(20)21/h1-9,18-19H,(H,20,21)(H,22,23,24) |
| InChIKey | XZZXSKLLOHOYFK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|