C18H15NO6S — CID 175367614
7-(benzoyloxymethylamino)-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 175367614) has the molecular formula C18H15NO6S and a molecular weight of 373.39 g/mol. Its IUPAC name is 7-(benzoyloxymethylamino)-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-(benzoyloxymethylamino)-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 175367614 |
| Molecular Formula | C18H15NO6S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 7-(benzoyloxymethylamino)-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=C(OCNc1ccc2c(O)cc(S(=O)(=O)O)cc2c1)c1ccccc1 |
| InChI | InChI=1S/C18H15NO6S/c20-17-10-15(26(22,23)24)9-13-8-14(6-7-16(13)17)19-11-25-18(21)12-4-2-1-3-5-12/h1-10,19-20H,11H2,(H,22,23,24) |
| InChIKey | DPLISKPWHUKGBA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|