C10H8O6S2 — CID 20586983
7-hydroperoxysulfanyl-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 20586983) has the molecular formula C10H8O6S2 and a molecular weight of 288.30 g/mol. Its IUPAC name is 7-hydroperoxysulfanyl-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-hydroperoxysulfanyl-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 20586983 |
| Molecular Formula | C10H8O6S2 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 7-hydroperoxysulfanyl-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2ccc(SOO)cc2c1 |
| InChI | InChI=1S/C10H8O6S2/c11-10-5-8(18(13,14)15)4-6-3-7(17-16-12)1-2-9(6)10/h1-5,11-12H,(H,13,14,15) |
| InChIKey | MJRRVKFWXOEGEW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|