C18H19NO8S2 — CID 88689633
7-amino-4-hydroxynaphthalene-2-sulfonic acid;2-methoxy-4-methylbenzenesulfonic acid (PubChem CID 88689633) has the molecular formula C18H19NO8S2 and a molecular weight of 441.48 g/mol. Its IUPAC name is 7-amino-4-hydroxynaphthalene-2-sulfonic acid;2-methoxy-4-methylbenzenesulfonic acid.
| Compound Name | 7-amino-4-hydroxynaphthalene-2-sulfonic acid;2-methoxy-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88689633 |
| Molecular Formula | C18H19NO8S2 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 7-amino-4-hydroxynaphthalene-2-sulfonic acid;2-methoxy-4-methylbenzenesulfonic acid |
| SMILES | COc1cc(C)ccc1S(=O)(=O)O.Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C10H9NO4S.C8H10O4S/c11-7-1-2-9-6(3-7)4-8(5-10(9)12)16(13,14)15;1-6-3-4-8(13(9,10)11)7(5-6)12-2/h1-5,12H,11H2,(H,13,14,15);3-5H,1-2H3,(H,9,10,11) |
| InChIKey | XPTRKKGIGMLGPD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 164.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|