C34H27N5O10S2 — CID 136814830
3-[[4-[4-[(7-amino-2-hydroxynaphthalen-1-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136814830) has the molecular formula C34H27N5O10S2 and a molecular weight of 729.75 g/mol. Its IUPAC name is 3-[[4-[4-[(7-amino-2-hydroxynaphthalen-1-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3-[[4-[4-[(7-amino-2-hydroxynaphthalen-1-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136814830 |
| Molecular Formula | C34H27N5O10S2 |
| Molecular Weight | 729.75 g/mol |
| Exact Mass | 729.12 |
| IUPAC Name | 3-[[4-[4-[(7-amino-2-hydroxynaphthalen-1-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | COc1cc(-c2ccc(/N=N/c3c(O)ccc4ccc(N)cc34)c(OC)c2)ccc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)ccc2c1O |
| InChI | InChI=1S/C34H27N5O10S2/c1-48-29-14-19(4-10-26(29)36-38-32-25-17-22(35)7-3-18(25)6-12-28(32)40)20-5-11-27(30(15-20)49-2)37-39-33-31(51(45,46)47)16-21-13-23(50(42,43)44)8-9-24(21)34(33)41/h3-17,40-41H,35H2,1-2H3,(H,42,43,44)(H,45,46,47)/b38-36+,39-37+ |
| InChIKey | JNHFNSICRWLXDF-NFSGFYSESA-N |
| XLogP | 7.99 |
| TPSA | 243.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.75 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|