C40H30N4O10S2 — CID 135853648
4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-7-phenylnaphthalene-2-sulfonic acid (PubChem CID 135853648) has the molecular formula C40H30N4O10S2 and a molecular weight of 790.83 g/mol. Its IUPAC name is 4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-7-phenylnaphthalene-2-sulfonic acid.
| Compound Name | 4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-7-phenylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135853648 |
| Molecular Formula | C40H30N4O10S2 |
| Molecular Weight | 790.83 g/mol |
| Exact Mass | 790.14 |
| IUPAC Name | 4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-7-phenylnaphthalene-2-sulfonic acid |
| SMILES | COc1cc(-c2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(-c5ccccc5)ccc4c3O)c(OC)c2)ccc1/N=N/c1cc(S(=O)(=O)O)c2ccccc2c1O |
| InChI | InChI=1S/C40H30N4O10S2/c1-53-34-19-25(13-16-31(34)41-43-33-22-36(55(47,48)49)29-10-6-7-11-30(29)39(33)45)26-14-17-32(35(20-26)54-2)42-44-38-37(56(50,51)52)21-27-18-24(12-15-28(27)40(38)46)23-8-4-3-5-9-23/h3-22,45-46H,1-2H3,(H,47,48,49)(H,50,51,52)/b43-41+,44-42+ |
| InChIKey | ORDRRRPGEJLPEB-CHQNLTHESA-N |
| XLogP | 10.08 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.83 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|