C34H26N4O12S2 — CID 136814817
3-[[4-[4-[(1,8-dihydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-4,5-dihydroxynaphthalene-1-sulfonic acid (PubChem CID 136814817) has the molecular formula C34H26N4O12S2 and a molecular weight of 746.73 g/mol. Its IUPAC name is 3-[[4-[4-[(1,8-dihydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-4,5-dihydroxynaphthalene-1-sulfonic acid.
| Compound Name | 3-[[4-[4-[(1,8-dihydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-4,5-dihydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136814817 |
| Molecular Formula | C34H26N4O12S2 |
| Molecular Weight | 746.73 g/mol |
| Exact Mass | 746.10 |
| IUPAC Name | 3-[[4-[4-[(1,8-dihydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-4,5-dihydroxynaphthalene-1-sulfonic acid |
| SMILES | COc1cc(-c2ccc(/N=N/c3cc(S(=O)(=O)O)c4cccc(O)c4c3O)c(OC)c2)ccc1/N=N/c1cc(S(=O)(=O)O)c2cccc(O)c2c1O |
| InChI | InChI=1S/C34H26N4O12S2/c1-49-27-13-17(9-11-21(27)35-37-23-15-29(51(43,44)45)19-5-3-7-25(39)31(19)33(23)41)18-10-12-22(28(14-18)50-2)36-38-24-16-30(52(46,47)48)20-6-4-8-26(40)32(20)34(24)42/h3-16,39-42H,1-2H3,(H,43,44,45)(H,46,47,48)/b37-35+,38-36+ |
| InChIKey | AEEOWGBHOQXLBS-ATXIYDNESA-N |
| XLogP | 7.82 |
| TPSA | 257.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.73 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|