C26H22N4O6 — CID 136628846
4-[[4-[4-[(3,4-dihydroxyphenyl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]benzene-1,2-diol (PubChem CID 136628846) has the molecular formula C26H22N4O6 and a molecular weight of 486.48 g/mol. Its IUPAC name is 4-[[4-[4-[(3,4-dihydroxyphenyl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]benzene-1,2-diol.
| Compound Name | 4-[[4-[4-[(3,4-dihydroxyphenyl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136628846 |
| Molecular Formula | C26H22N4O6 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-[[4-[4-[(3,4-dihydroxyphenyl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]benzene-1,2-diol |
| SMILES | COc1cc(-c2ccc(/N=N/c3ccc(O)c(O)c3)c(OC)c2)ccc1/N=N/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C26H22N4O6/c1-35-25-11-15(3-7-19(25)29-27-17-5-9-21(31)23(33)13-17)16-4-8-20(26(12-16)36-2)30-28-18-6-10-22(32)24(34)14-18/h3-14,31-34H,1-2H3/b29-27+,30-28+ |
| InChIKey | XWYGGEDFIGDZES-QAVVBOBSSA-N |
| XLogP | 7.02 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|