About 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol
3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol (PubChem CID 136991159) has the molecular formula C16H18N2O5
and a molecular weight of 318.33 g/mol. Its IUPAC name is 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol.
Molecular Properties
| Compound Name | 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol |
| PubChem CID | 136991159 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol |
| SMILES | COc1cc(O)ccc1/N=N/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H18N2O5/c1-20-13-9-11(19)5-6-12(13)18-17-10-7-14(21-2)16(23-4)15(8-10)22-3/h5-9,19H,1-4H3/b18-17+ |
| InChIKey | ANDQVPGPWBLDOR-ISLYRVAYSA-N |
| XLogP | 3.84 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol?
The IUPAC name of 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol (CID 136991159) is 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol.
What is the SMILES notation for 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol?
The canonical SMILES for 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol is COc1cc(O)ccc1/N=N/c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol?
The InChIKey is ANDQVPGPWBLDOR-ISLYRVAYSA-N. The full InChI is InChI=1S/C16H18N2O5/c1-20-13-9-11(19)5-6-12(13)18-17-10-7-14(21-2)16(23-4)15(8-10)22-3/h5-9,19H,1-4H3/b18-17+.
What are the key properties of 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol?
3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol has a molecular weight of 318.33 g/mol, XLogP of 3.84, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-[(3,4,5-trimethoxyphenyl)diazenyl]phenol is sourced from PubChem (CID 136991159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).