C34H28N6O12S3 — CID 159048827
4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5-sulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methoxyphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid (PubChem CID 159048827) has the molecular formula C34H28N6O12S3 and a molecular weight of 808.83 g/mol. Its IUPAC name is 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5-sulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methoxyphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid.
| Compound Name | 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5-sulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methoxyphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 159048827 |
| Molecular Formula | C34H28N6O12S3 |
| Molecular Weight | 808.83 g/mol |
| Exact Mass | 808.09 |
| IUPAC Name | 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5-sulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methoxyphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
| SMILES | COc1cc(-c2ccc(/N=N/c3ccc4c(S(=O)(=O)O)ccc(N)c4c3O)c(C)c2)ccc1/N=N/c1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c2c1O |
| InChI | InChI=1S/C34H28N6O12S3/c1-16-13-17(3-8-22(16)37-39-24-10-5-19-27(53(43,44)45)12-7-21(35)30(19)33(24)41)18-4-9-23(26(14-18)52-2)38-40-25-11-6-20-28(54(46,47)48)15-29(55(49,50)51)32(36)31(20)34(25)42/h3-15,41-42H,35-36H2,1-2H3,(H,43,44,45)(H,46,47,48)(H,49,50,51)/b39-37+,40-38+ |
| InChIKey | QYDIIDVVAIUAHN-HVMBLDELSA-N |
| XLogP | 7.12 |
| TPSA | 314.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.83 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|