C34H37N5O12S2 — CID 170530788
5-[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (PubChem CID 170530788) has the molecular formula C34H37N5O12S2 and a molecular weight of 771.83 g/mol. Its IUPAC name is 5-[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid.
| Compound Name | 5-[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 170530788 |
| Molecular Formula | C34H37N5O12S2 |
| Molecular Weight | 771.83 g/mol |
| Exact Mass | 771.19 |
| IUPAC Name | 5-[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| SMILES | Cc1cc(-c2ccc(NC(=O)CCC(NC(=O)OC(C)(C)C)C(=O)O)c(C)c2)ccc1/N=N/c1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c2c1O |
| InChI | InChI=1S/C34H37N5O12S2/c1-17-14-19(6-9-22(17)36-28(40)13-12-25(32(42)43)37-33(44)51-34(3,4)5)20-7-10-23(18(2)15-20)38-39-24-11-8-21-26(52(45,46)47)16-27(53(48,49)50)30(35)29(21)31(24)41/h6-11,14-16,25,41H,12-13,35H2,1-5H3,(H,36,40)(H,37,44)(H,42,43)(H,45,46,47)(H,48,49,50)/b39-38+ |
| InChIKey | WIDWMJFBEGHVJB-YMZYAJTMSA-N |
| XLogP | 6.02 |
| TPSA | 284.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.83 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|