C25H36N4O3 — CID 155476618
tert-butyl N-[(5S)-5-amino-6-[4-(4-amino-3-methylphenyl)-2-methylanilino]-6-oxohexyl]carbamate (PubChem CID 155476618) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-amino-6-[4-(4-amino-3-methylphenyl)-2-methylanilino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-amino-6-[4-(4-amino-3-methylphenyl)-2-methylanilino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 155476618 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | tert-butyl N-[(5S)-5-amino-6-[4-(4-amino-3-methylphenyl)-2-methylanilino]-6-oxohexyl]carbamate |
| SMILES | Cc1cc(-c2ccc(NC(=O)[C@@H](N)CCCCNC(=O)OC(C)(C)C)c(C)c2)ccc1N |
| InChI | InChI=1S/C25H36N4O3/c1-16-14-18(9-11-20(16)26)19-10-12-22(17(2)15-19)29-23(30)21(27)8-6-7-13-28-24(31)32-25(3,4)5/h9-12,14-15,21H,6-8,13,26-27H2,1-5H3,(H,28,31)(H,29,30)/t21-/m0/s1 |
| InChIKey | IUSQUPPRZQFUDO-NRFANRHFSA-N |
| XLogP | 4.51 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|