C18H28ClN3O3 — CID 118899202
tert-butyl N-[(5S)-5-amino-6-[(3-chlorophenyl)methylamino]-6-oxohexyl]carbamate (PubChem CID 118899202) has the molecular formula C18H28ClN3O3 and a molecular weight of 369.89 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-amino-6-[(3-chlorophenyl)methylamino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-amino-6-[(3-chlorophenyl)methylamino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 118899202 |
| Molecular Formula | C18H28ClN3O3 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | tert-butyl N-[(5S)-5-amino-6-[(3-chlorophenyl)methylamino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](N)C(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H28ClN3O3/c1-18(2,3)25-17(24)21-10-5-4-9-15(20)16(23)22-12-13-7-6-8-14(19)11-13/h6-8,11,15H,4-5,9-10,12,20H2,1-3H3,(H,21,24)(H,22,23)/t15-/m0/s1 |
| InChIKey | LHNNRUXIWXZSPH-HNNXBMFYSA-N |
| XLogP | 2.98 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|