C20H28N4O3S — CID 156819595
tert-butyl N-[(5S)-5-amino-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamate (PubChem CID 156819595) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-amino-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-amino-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 156819595 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | tert-butyl N-[(5S)-5-amino-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](N)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H28N4O3S/c1-20(2,3)27-19(26)22-12-8-7-11-15(21)17(25)24-18-23-16(13-28-18)14-9-5-4-6-10-14/h4-6,9-10,13,15H,7-8,11-12,21H2,1-3H3,(H,22,26)(H,23,24,25)/t15-/m0/s1 |
| InChIKey | UQWPCWKMGMVVDA-HNNXBMFYSA-N |
| XLogP | 3.77 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|