C26H33N5O6S2 — CID 166682075
tert-butyl N-[5-[(1-methylsulfonylpyrrole-3-carbonyl)amino]-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamate (PubChem CID 166682075) has the molecular formula C26H33N5O6S2 and a molecular weight of 575.71 g/mol. Its IUPAC name is tert-butyl N-[5-[(1-methylsulfonylpyrrole-3-carbonyl)amino]-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[5-[(1-methylsulfonylpyrrole-3-carbonyl)amino]-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 166682075 |
| Molecular Formula | C26H33N5O6S2 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | tert-butyl N-[5-[(1-methylsulfonylpyrrole-3-carbonyl)amino]-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(NC(=O)c1ccn(S(C)(=O)=O)c1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C26H33N5O6S2/c1-26(2,3)37-25(34)27-14-9-8-12-20(28-22(32)19-13-15-31(16-19)39(4,35)36)23(33)30-24-29-21(17-38-24)18-10-6-5-7-11-18/h5-7,10-11,13,15-17,20H,8-9,12,14H2,1-4H3,(H,27,34)(H,28,32)(H,29,30,33) |
| InChIKey | BGNLLTCPBFMLEQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|