C15H21N5O3S2 — CID 75074322
2-amino-N-(4-phenyl-1,3-thiazol-2-yl)-6-(sulfamoylamino)hexanamide (PubChem CID 75074322) has the molecular formula C15H21N5O3S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-amino-N-(4-phenyl-1,3-thiazol-2-yl)-6-(sulfamoylamino)hexanamide.
| Compound Name | 2-amino-N-(4-phenyl-1,3-thiazol-2-yl)-6-(sulfamoylamino)hexanamide |
|---|---|
| PubChem CID | 75074322 |
| Molecular Formula | C15H21N5O3S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-amino-N-(4-phenyl-1,3-thiazol-2-yl)-6-(sulfamoylamino)hexanamide |
| SMILES | NC(CCCCNS(N)(=O)=O)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H21N5O3S2/c16-12(8-4-5-9-18-25(17,22)23)14(21)20-15-19-13(10-24-15)11-6-2-1-3-7-11/h1-3,6-7,10,12,18H,4-5,8-9,16H2,(H2,17,22,23)(H,19,20,21) |
| InChIKey | RSERVPWYQIBMMZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|