C27H35N5O5S2 — CID 59028862
benzyl N-[(2S)-1-[[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate (PubChem CID 59028862) has the molecular formula C27H35N5O5S2 and a molecular weight of 573.74 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59028862 |
| Molecular Formula | C27H35N5O5S2 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | benzyl N-[(2S)-1-[[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate |
| SMILES | CC(C)(C)c1ccc(-c2csc(NC(=O)[C@H](CCCCNS(N)(=O)=O)NC(=O)OCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C27H35N5O5S2/c1-27(2,3)21-14-12-20(13-15-21)23-18-38-25(30-23)32-24(33)22(11-7-8-16-29-39(28,35)36)31-26(34)37-17-19-9-5-4-6-10-19/h4-6,9-10,12-15,18,22,29H,7-8,11,16-17H2,1-3H3,(H,31,34)(H2,28,35,36)(H,30,32,33)/t22-/m0/s1 |
| InChIKey | QPIDTAOQRNEYGS-QFIPXVFZSA-N |
| XLogP | 4.30 |
| TPSA | 152.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|