C20H27N5O5S — CID 59028941
benzyl N-[(2S)-1-oxo-1-(pyridin-2-ylmethylamino)-6-(sulfamoylamino)hexan-2-yl]carbamate (PubChem CID 59028941) has the molecular formula C20H27N5O5S and a molecular weight of 449.53 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-1-(pyridin-2-ylmethylamino)-6-(sulfamoylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-1-(pyridin-2-ylmethylamino)-6-(sulfamoylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59028941 |
| Molecular Formula | C20H27N5O5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-1-(pyridin-2-ylmethylamino)-6-(sulfamoylamino)hexan-2-yl]carbamate |
| SMILES | NS(=O)(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C20H27N5O5S/c21-31(28,29)24-13-7-5-11-18(19(26)23-14-17-10-4-6-12-22-17)25-20(27)30-15-16-8-2-1-3-9-16/h1-4,6,8-10,12,18,24H,5,7,11,13-15H2,(H,23,26)(H,25,27)(H2,21,28,29)/t18-/m0/s1 |
| InChIKey | LEHLHCVDYRHNDC-SFHVURJKSA-N |
| XLogP | 0.96 |
| TPSA | 152.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|