C28H29Cl2N3O4 — CID 171649634
benzyl N-[1-(benzylamino)-6-[(2,6-dichlorobenzoyl)amino]-1-oxohexan-2-yl]carbamate (PubChem CID 171649634) has the molecular formula C28H29Cl2N3O4 and a molecular weight of 542.46 g/mol. Its IUPAC name is benzyl N-[1-(benzylamino)-6-[(2,6-dichlorobenzoyl)amino]-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(benzylamino)-6-[(2,6-dichlorobenzoyl)amino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 171649634 |
| Molecular Formula | C28H29Cl2N3O4 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | benzyl N-[1-(benzylamino)-6-[(2,6-dichlorobenzoyl)amino]-1-oxohexan-2-yl]carbamate |
| SMILES | O=C(NC(CCCCNC(=O)c1c(Cl)cccc1Cl)C(=O)NCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C28H29Cl2N3O4/c29-22-14-9-15-23(30)25(22)27(35)31-17-8-7-16-24(26(34)32-18-20-10-3-1-4-11-20)33-28(36)37-19-21-12-5-2-6-13-21/h1-6,9-15,24H,7-8,16-19H2,(H,31,35)(H,32,34)(H,33,36) |
| InChIKey | ZHLQWKSOFGYKTP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|