C22H28N4O5 — CID 11407718
benzyl N-[(2S)-8-(hydroxyamino)-1,8-dioxo-1-(pyridin-4-ylmethylamino)octan-2-yl]carbamate (PubChem CID 11407718) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is benzyl N-[(2S)-8-(hydroxyamino)-1,8-dioxo-1-(pyridin-4-ylmethylamino)octan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-8-(hydroxyamino)-1,8-dioxo-1-(pyridin-4-ylmethylamino)octan-2-yl]carbamate |
|---|---|
| PubChem CID | 11407718 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | benzyl N-[(2S)-8-(hydroxyamino)-1,8-dioxo-1-(pyridin-4-ylmethylamino)octan-2-yl]carbamate |
| SMILES | O=C(CCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)NCc1ccncc1)NO |
| InChI | InChI=1S/C22H28N4O5/c27-20(26-30)10-6-2-5-9-19(21(28)24-15-17-11-13-23-14-12-17)25-22(29)31-16-18-7-3-1-4-8-18/h1,3-4,7-8,11-14,19,30H,2,5-6,9-10,15-16H2,(H,24,28)(H,25,29)(H,26,27)/t19-/m0/s1 |
| InChIKey | XOKCJVAGWSDSCD-IBGZPJMESA-N |
| XLogP | 2.45 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|