C25H24N4O3 — CID 42910159
benzyl N-[3-(1H-indol-3-yl)-1-oxo-1-(pyridin-2-ylmethylamino)propan-2-yl]carbamate (PubChem CID 42910159) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is benzyl N-[3-(1H-indol-3-yl)-1-oxo-1-(pyridin-2-ylmethylamino)propan-2-yl]carbamate.
| Compound Name | benzyl N-[3-(1H-indol-3-yl)-1-oxo-1-(pyridin-2-ylmethylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 42910159 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | benzyl N-[3-(1H-indol-3-yl)-1-oxo-1-(pyridin-2-ylmethylamino)propan-2-yl]carbamate |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)NCc1ccccn1)OCc1ccccc1 |
| InChI | InChI=1S/C25H24N4O3/c30-24(28-16-20-10-6-7-13-26-20)23(14-19-15-27-22-12-5-4-11-21(19)22)29-25(31)32-17-18-8-2-1-3-9-18/h1-13,15,23,27H,14,16-17H2,(H,28,30)(H,29,31) |
| InChIKey | XHHPREQTUWBJTB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |