C24H27F2N5O6S2 — CID 59029044
benzyl N-[(2S)-1-[[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate (PubChem CID 59029044) has the molecular formula C24H27F2N5O6S2 and a molecular weight of 583.64 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59029044 |
| Molecular Formula | C24H27F2N5O6S2 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | benzyl N-[(2S)-1-[[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate |
| SMILES | NS(=O)(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1nc(-c2ccc(OC(F)F)cc2)cs1 |
| InChI | InChI=1S/C24H27F2N5O6S2/c25-22(26)37-18-11-9-17(10-12-18)20-15-38-23(29-20)31-21(32)19(8-4-5-13-28-39(27,34)35)30-24(33)36-14-16-6-2-1-3-7-16/h1-3,6-7,9-12,15,19,22,28H,4-5,8,13-14H2,(H,30,33)(H2,27,34,35)(H,29,31,32)/t19-/m0/s1 |
| InChIKey | KKRVIYAJZZUVPI-IBGZPJMESA-N |
| XLogP | 3.61 |
| TPSA | 161.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|