C26H22N4O5S — CID 2218066
benzyl N-[(2S)-3-(4-nitrophenyl)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl]carbamate (PubChem CID 2218066) has the molecular formula C26H22N4O5S and a molecular weight of 502.55 g/mol. Its IUPAC name is benzyl N-[(2S)-3-(4-nitrophenyl)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-(4-nitrophenyl)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 2218066 |
| Molecular Formula | C26H22N4O5S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | benzyl N-[(2S)-3-(4-nitrophenyl)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)Nc1nc(-c2ccccc2)cs1)OCc1ccccc1 |
| InChI | InChI=1S/C26H22N4O5S/c31-24(29-25-27-23(17-36-25)20-9-5-2-6-10-20)22(15-18-11-13-21(14-12-18)30(33)34)28-26(32)35-16-19-7-3-1-4-8-19/h1-14,17,22H,15-16H2,(H,28,32)(H,27,29,31)/t22-/m0/s1 |
| InChIKey | WALVPXUNNFKHJX-QFIPXVFZSA-N |
| XLogP | 5.19 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|